CAS 875446-03-0 appears in our catalog under these names: 4-(3,4-Difluorophenyl)pyrrolidin-2-one, 98%, 4-(3,4-Difluorophenyl)pyrrolidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 100mg, 1g.
4-(3,4-difluorophenyl)pyrrolidin-2-one (CAS 875446-03-0) is a chemical compound with the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. IUPAC name: 4-(3,4-difluorophenyl)pyrrolidin-2-one. InChIKey: WEBXSXICEYKMAI-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO |
|---|---|
| Molecular weight | 197.18 g/mol |
| IUPAC name | 4-(3,4-difluorophenyl)pyrrolidin-2-one |
| InChIKey | WEBXSXICEYKMAI-UHFFFAOYSA-N |
| SMILES | C1C(CNC1=O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)