CAS 87547-04-4 appears in our catalog under these names: 2-(2-Chloro-5-(1,3-dioxo-4,5,6,7-tetrahydro-1h-isoindol-2(3h)-yl)-4-fluorophenoxy)acetic acid, 95%, Flumiclorac (free acid), Flumiclorac. Offered by: Combi-blocks, Dr. Ehrenstorfer, Chemat. Available pack sizes: 1g, 250mg, 25mg, 50mg.
2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenoxy]acetic acid (CAS 87547-04-4) is a chemical compound with the molecular formula C16H13ClFNO5 and a molecular weight of 353.73 g/mol. IUPAC name: 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenoxy]acetic acid. InChIKey: GQQIAHNFBAFBCS-UHFFFAOYSA-N.
| Molecular formula | C16H13ClFNO5 |
|---|---|
| Molecular weight | 353.73 g/mol |
| IUPAC name | 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenoxy]acetic acid |
| InChIKey | GQQIAHNFBAFBCS-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)N(C2=O)C3=CC(=C(C=C3F)Cl)OCC(=O)O |
Computed by PubChem (NCBI)