CAS 875535-36-7 appears in our catalog under these names: Diacerein EP Impurity E (4-Acetyl Rhein), Diacerein EP Impurity E, Diacerein Impurity E, 4-Acetyl Rhein, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 5mg.
4-acetyloxy-5-hydroxy-9,10-dioxoanthracene-2-carboxylic acid (CAS 875535-36-7) is a chemical compound with the molecular formula C17H10O7 and a molecular weight of 326.26 g/mol. IUPAC name: 4-acetyloxy-5-hydroxy-9,10-dioxoanthracene-2-carboxylic acid. InChIKey: FRIXMWPJYKVOCV-UHFFFAOYSA-N.
| Molecular formula | C17H10O7 |
|---|---|
| Molecular weight | 326.26 g/mol |
| IUPAC name | 4-acetyloxy-5-hydroxy-9,10-dioxoanthracene-2-carboxylic acid |
| InChIKey | FRIXMWPJYKVOCV-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=CC2=C1C(=O)C3=C(C2=O)C=CC=C3O)C(=O)O |
Computed by PubChem (NCBI)