Products 875841-51-3

CAS 875841-51-3 is the registry number for 2-Amino-4-Mercapto-3,3-Dimethylbutyric Acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-amino-3,3-dimethyl-4-sulfanylbutanoic acid (CAS 875841-51-3) is a chemical compound with the molecular formula C6H13NO2S and a molecular weight of 163.24 g/mol. IUPAC name: 2-amino-3,3-dimethyl-4-sulfanylbutanoic acid. InChIKey: FQBOFJFMHAZEAN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13NO2S
Molecular weight163.24 g/mol
IUPAC name2-amino-3,3-dimethyl-4-sulfanylbutanoic acid
InChIKeyFQBOFJFMHAZEAN-UHFFFAOYSA-N
SMILESCC(C)(CS)C(C(=O)O)N

Computed by PubChem (NCBI)