CAS 876-90-4 appears in our catalog under these names: 6-Fluorocinnolin-4-ol, 98%, 6-Fluoro-1,4-dihydrocinnolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-fluoro-1H-cinnolin-4-one (CAS 876-90-4) is a chemical compound with the molecular formula C8H5FN2O and a molecular weight of 164.14 g/mol. IUPAC name: 6-fluoro-1H-cinnolin-4-one. InChIKey: SPWDLJIYXFPDGC-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O |
|---|---|
| Molecular weight | 164.14 g/mol |
| IUPAC name | 6-fluoro-1H-cinnolin-4-one |
| InChIKey | SPWDLJIYXFPDGC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)C=NN2 |
Computed by PubChem (NCBI)