CAS 876343-82-7 appears in our catalog under these names: 5–Bromo–4–chloro–1H–pyrrolo(2,3–b)pyridine, 5-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine, 96%. Offered by: GLPBio, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g.
5-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine (CAS 876343-82-7) is a chemical compound with the molecular formula C7H4BrClN2 and a molecular weight of 231.48 g/mol. IUPAC name: 5-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine. InChIKey: FMDQNRHKEYTVBW-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2 |
|---|---|
| Molecular weight | 231.48 g/mol |
| IUPAC name | 5-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | FMDQNRHKEYTVBW-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C(=C21)Cl)Br |
Computed by PubChem (NCBI)