CAS 876345-13-0 appears in our catalog under these names: 2,2-Dimethyl-4-oxo-3,8,11,14,17-pentaoxa-5-azanonadecan-19-oic acid, 97%, Boc-NH-PEG4-CH2COOH/ 99.84% (existing batch purity), Boc–NH–PEG4–CH2COOH, BocNH-PEG4-CH2COOH, Boc-NH-PEG4-CH2COOH 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg, 25mg, 50mg.
2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 876345-13-0) is a chemical compound with the molecular formula C15H29NO8 and a molecular weight of 351.39 g/mol. IUPAC name: 2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: SHMYENBXRNPSOG-UHFFFAOYSA-N.
| Molecular formula | C15H29NO8 |
|---|---|
| Molecular weight | 351.39 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | SHMYENBXRNPSOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)