Products 876346-93-9

CAS 876346-93-9 is the registry number for tert-Butyl N-(2-hydroxy-4-iodophenyl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-hydroxy-4-iodophenyl)carbamate (CAS 876346-93-9) is a chemical compound with the molecular formula C11H14INO3 and a molecular weight of 335.14 g/mol. IUPAC name: tert-butyl N-(2-hydroxy-4-iodophenyl)carbamate. InChIKey: PMFZMESMKUGVCD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14INO3
Molecular weight335.14 g/mol
IUPAC nametert-butyl N-(2-hydroxy-4-iodophenyl)carbamate
InChIKeyPMFZMESMKUGVCD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=C(C=C(C=C1)I)O

Computed by PubChem (NCBI)