Products 876497-67-5

CAS 876497-67-5 is the registry number for N-(2-bromophenyl)nitrous amide. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

N-(2-bromophenyl)nitrous amide (CAS 876497-67-5) is a chemical compound with the molecular formula C6H5BrN2O and a molecular weight of 201.02 g/mol. IUPAC name: N-(2-bromophenyl)nitrous amide. InChIKey: GRFPGRQELVAOGF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrN2O
Molecular weight201.02 g/mol
IUPAC nameN-(2-bromophenyl)nitrous amide
InChIKeyGRFPGRQELVAOGF-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)NN=O)Br

Computed by PubChem (NCBI)