Products 876623-93-7
CAS 876623-93-7 is the registry number for Benzyl ((S)-2-amino-3,3-dimethylbutanoyl)-L-prolinate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidine-2-carboxylate;hydrochloride (CAS 876623-93-7) is a chemical compound with the molecular formula C18H27ClN2O3 and a molecular weight of 354.9 g/mol. IUPAC name: benzyl (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidine-2-carboxylate;hydrochloride. InChIKey: NTSCZZDRNHLCHK-LDXVYITESA-N.
| Molecular formula | C18H27ClN2O3 |
|---|---|
| Molecular weight | 354.9 g/mol |
| IUPAC name | benzyl (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | NTSCZZDRNHLCHK-LDXVYITESA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)