Products 876725-64-3
CAS 876725-64-3 is the registry number for (3R)-3-Amino-2,3-dihydro-1H-inden-1-one Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg.
(3R)-3-amino-2,3-dihydroinden-1-one;hydrochloride (CAS 876725-64-3) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: (3R)-3-amino-2,3-dihydroinden-1-one;hydrochloride. InChIKey: XPLMUHLYLOBJST-DDWIOCJRSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | (3R)-3-amino-2,3-dihydroinden-1-one;hydrochloride |
| InChIKey | XPLMUHLYLOBJST-DDWIOCJRSA-N |
| SMILES | C1[C@H](C2=CC=CC=C2C1=O)N.Cl |
Computed by PubChem (NCBI)