CAS 876743-46-3 is the registry number for 5-O-tert-Butyldimethylsilylindole-3-acetaldehyde. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.
2-[5-[tert-butyl(dimethyl)silyl]oxy-1H-indol-3-yl]ethanol (CAS 876743-46-3) is a chemical compound with the molecular formula C16H25NO2Si and a molecular weight of 291.46 g/mol. IUPAC name: 2-[5-[tert-butyl(dimethyl)silyl]oxy-1H-indol-3-yl]ethanol. InChIKey: QGVHCLPYQKKMBJ-UHFFFAOYSA-N.
| Molecular formula | C16H25NO2Si |
|---|---|
| Molecular weight | 291.46 g/mol |
| IUPAC name | 2-[5-[tert-butyl(dimethyl)silyl]oxy-1H-indol-3-yl]ethanol |
| InChIKey | QGVHCLPYQKKMBJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1)NC=C2CCO |
Computed by PubChem (NCBI)