CAS 87679-18-3 appears in our catalog under these names: Cis-3,5-dimethylcyclohexane-1-carboxylic acid, 95%, cis-3,5-dimethylcyclohexane-1-carboxylic acid, 97%, cis-3,5-dimethylcyclohexane-1-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 500mg, 10g.
Cis-(3S,5R)-3,5-dimethylcyclohexane-1-carboxylic acid (CAS 87679-18-3) is a chemical compound with the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. IUPAC name: cis-(3S,5R)-3,5-dimethylcyclohexane-1-carboxylic acid. InChIKey: IBKKIFZBAGGCTR-DHBOJHSNSA-N.
| Molecular formula | C9H16O2 |
|---|---|
| Molecular weight | 156.22 g/mol |
| IUPAC name | cis-(3S,5R)-3,5-dimethylcyclohexane-1-carboxylic acid |
| InChIKey | IBKKIFZBAGGCTR-DHBOJHSNSA-N |
| SMILES | C[C@@H]1C[C@@H](CC(C1)C(=O)O)C |
Computed by PubChem (NCBI)