CAS 876874-30-5 is the registry number for 2,5-Dibromo-N-(1-methyl-1H-pyrazol-3-yl)benzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dibromo-N-(1-methylpyrazol-3-yl)benzenesulfonamide (CAS 876874-30-5) is a chemical compound with the molecular formula C10H9Br2N3O2S and a molecular weight of 395.07 g/mol. IUPAC name: 2,5-dibromo-N-(1-methylpyrazol-3-yl)benzenesulfonamide. InChIKey: QVTWDTHVNVDTJT-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2N3O2S |
|---|---|
| Molecular weight | 395.07 g/mol |
| IUPAC name | 2,5-dibromo-N-(1-methylpyrazol-3-yl)benzenesulfonamide |
| InChIKey | QVTWDTHVNVDTJT-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)NS(=O)(=O)C2=C(C=CC(=C2)Br)Br |
Computed by PubChem (NCBI)