CAS 876898-22-5 appears in our catalog under these names: ((3,4-Dichlorophenyl)methyl)(pyridin-2-ylmethyl)amine, 95%, ((3,4-Dichlorophenyl)methyl)(pyridin-2-ylmethyl)amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
1-(3,4-dichlorophenyl)-N-(pyridin-2-ylmethyl)methanamine (CAS 876898-22-5) is a chemical compound with the molecular formula C13H12Cl2N2 and a molecular weight of 267.15 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-N-(pyridin-2-ylmethyl)methanamine. InChIKey: DJSKSKCQEQMUQF-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2 |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-N-(pyridin-2-ylmethyl)methanamine |
| InChIKey | DJSKSKCQEQMUQF-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNCC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)