CAS 876934-59-7 is the registry number for 2-((1,3,4-Thiadiazol-2-yl)thio)-1-(thiophen-2-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,3,4-thiadiazol-2-ylsulfanyl)-1-thiophen-2-ylethanone (CAS 876934-59-7) is a chemical compound with the molecular formula C8H6N2OS3 and a molecular weight of 242.3 g/mol. IUPAC name: 2-(1,3,4-thiadiazol-2-ylsulfanyl)-1-thiophen-2-ylethanone. InChIKey: XMQAYSMOSONXDX-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS3 |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | 2-(1,3,4-thiadiazol-2-ylsulfanyl)-1-thiophen-2-ylethanone |
| InChIKey | XMQAYSMOSONXDX-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)CSC2=NN=CS2 |
Computed by PubChem (NCBI)