Products 877-19-0

CAS 877-19-0 is the registry number for Calcium Dobesilate Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3,6-dioxocyclohexa-1,4-diene-1-sulfonic acid (CAS 877-19-0) is a chemical compound with the molecular formula C6H4O5S and a molecular weight of 188.16 g/mol. IUPAC name: 3,6-dioxocyclohexa-1,4-diene-1-sulfonic acid. InChIKey: QOIXLGYJPBDQSK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4O5S
Molecular weight188.16 g/mol
IUPAC name3,6-dioxocyclohexa-1,4-diene-1-sulfonic acid
InChIKeyQOIXLGYJPBDQSK-UHFFFAOYSA-N
SMILESC1=CC(=O)C(=CC1=O)S(=O)(=O)O

Computed by PubChem (NCBI)