CAS 877-19-0 is the registry number for Calcium Dobesilate Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-dioxocyclohexa-1,4-diene-1-sulfonic acid (CAS 877-19-0) is a chemical compound with the molecular formula C6H4O5S and a molecular weight of 188.16 g/mol. IUPAC name: 3,6-dioxocyclohexa-1,4-diene-1-sulfonic acid. InChIKey: QOIXLGYJPBDQSK-UHFFFAOYSA-N.
| Molecular formula | C6H4O5S |
|---|---|
| Molecular weight | 188.16 g/mol |
| IUPAC name | 3,6-dioxocyclohexa-1,4-diene-1-sulfonic acid |
| InChIKey | QOIXLGYJPBDQSK-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)C(=CC1=O)S(=O)(=O)O |
Computed by PubChem (NCBI)