Products 87700-60-5

CAS 87700-60-5 is the registry number for 6-Bromonaphthalene-2-carbonyl chloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

6-bromonaphthalene-2-carbonyl chloride (CAS 87700-60-5) is a chemical compound with the molecular formula C11H6BrClO and a molecular weight of 269.52 g/mol. IUPAC name: 6-bromonaphthalene-2-carbonyl chloride. InChIKey: CZPOKTBIKWSWIP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6BrClO
Molecular weight269.52 g/mol
IUPAC name6-bromonaphthalene-2-carbonyl chloride
InChIKeyCZPOKTBIKWSWIP-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC(=C2)Br)C=C1C(=O)Cl

Computed by PubChem (NCBI)