CAS 87700-60-5 is the registry number for 6-Bromonaphthalene-2-carbonyl chloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-bromonaphthalene-2-carbonyl chloride (CAS 87700-60-5) is a chemical compound with the molecular formula C11H6BrClO and a molecular weight of 269.52 g/mol. IUPAC name: 6-bromonaphthalene-2-carbonyl chloride. InChIKey: CZPOKTBIKWSWIP-UHFFFAOYSA-N.
| Molecular formula | C11H6BrClO |
|---|---|
| Molecular weight | 269.52 g/mol |
| IUPAC name | 6-bromonaphthalene-2-carbonyl chloride |
| InChIKey | CZPOKTBIKWSWIP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1C(=O)Cl |
Computed by PubChem (NCBI)