CAS 877078-00-7 is the registry number for 2-Chloroquinoxaline-6-sulphonyl chloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-chloroquinoxaline-6-sulfonyl chloride (CAS 877078-00-7) is a chemical compound with the molecular formula C8H4Cl2N2O2S and a molecular weight of 263.10 g/mol. IUPAC name: 2-chloroquinoxaline-6-sulfonyl chloride. InChIKey: XRFZYTKDWOECHH-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O2S |
|---|---|
| Molecular weight | 263.10 g/mol |
| IUPAC name | 2-chloroquinoxaline-6-sulfonyl chloride |
| InChIKey | XRFZYTKDWOECHH-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN=C2C=C1S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)