Products 877078-00-7

CAS 877078-00-7 is the registry number for 2-Chloroquinoxaline-6-sulphonyl chloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-chloroquinoxaline-6-sulfonyl chloride (CAS 877078-00-7) is a chemical compound with the molecular formula C8H4Cl2N2O2S and a molecular weight of 263.10 g/mol. IUPAC name: 2-chloroquinoxaline-6-sulfonyl chloride. InChIKey: XRFZYTKDWOECHH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4Cl2N2O2S
Molecular weight263.10 g/mol
IUPAC name2-chloroquinoxaline-6-sulfonyl chloride
InChIKeyXRFZYTKDWOECHH-UHFFFAOYSA-N
SMILESC1=CC2=NC(=CN=C2C=C1S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)