CAS 877263-70-2 is the registry number for 4-Bromo-1-chloro-7-methylisoquinoline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-1-chloro-7-methylisoquinoline (CAS 877263-70-2) is a chemical compound with the molecular formula C10H7BrClN and a molecular weight of 256.52 g/mol. IUPAC name: 4-bromo-1-chloro-7-methylisoquinoline. InChIKey: RLZBFEFWWHJZNE-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClN |
|---|---|
| Molecular weight | 256.52 g/mol |
| IUPAC name | 4-bromo-1-chloro-7-methylisoquinoline |
| InChIKey | RLZBFEFWWHJZNE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN=C2Cl)Br |
Computed by PubChem (NCBI)