CAS 87736-79-6 is the registry number for 2,2,2-Trifluoro-1-(4-methylphenyl)ethanone O-Tosyl Oxime, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g.
[[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] 4-methylbenzenesulfonate (CAS 87736-79-6) is a chemical compound with the molecular formula C16H14F3NO3S and a molecular weight of 357.3 g/mol. IUPAC name: [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] 4-methylbenzenesulfonate. InChIKey: GHAOMANCFBUXTJ-UHFFFAOYSA-N.
| Molecular formula | C16H14F3NO3S |
|---|---|
| Molecular weight | 357.3 g/mol |
| IUPAC name | [[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]amino] 4-methylbenzenesulfonate |
| InChIKey | GHAOMANCFBUXTJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=NOS(=O)(=O)C2=CC=C(C=C2)C)C(F)(F)F |
Computed by PubChem (NCBI)