CAS 877402-45-4 appears in our catalog under these names: Sitagliptin Impurity 44, Sitagliptin Impurity A, 3-(Trifluoromethyl)-6,7-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-8(5H)-one, 98%, Sitagliptin Impurity 114, 3-(Trifluoromethyl)-6,7-dihydro-(1,2,4)triazolo(4,3-a)pyrazin-8(5H)-one. Offered by: Chemat Brand, Hubei YoungXin, Mikromol, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-8-one (CAS 877402-45-4) is a chemical compound with the molecular formula C6H5F3N4O and a molecular weight of 206.13 g/mol. IUPAC name: 3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-8-one. InChIKey: RJNNTMBQPSTNQP-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N4O |
|---|---|
| Molecular weight | 206.13 g/mol |
| IUPAC name | 3-(trifluoromethyl)-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
| InChIKey | RJNNTMBQPSTNQP-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NN=C2C(F)(F)F)C(=O)N1 |
Computed by PubChem (NCBI)