Products 877462-71-0
CAS 877462-71-0 is the registry number for TriDAP. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-6-[[(4R)-4-[[(2S)-2-aminopropanoyl]amino]-4-carboxybutanoyl]amino]heptanedioic acid (CAS 877462-71-0) is a chemical compound with the molecular formula C15H26N4O8 and a molecular weight of 390.39 g/mol. IUPAC name: 2-amino-6-[[(4R)-4-[[(2S)-2-aminopropanoyl]amino]-4-carboxybutanoyl]amino]heptanedioic acid. InChIKey: FMNCPUGORYYCEM-AUXWQGHOSA-N.
| Molecular formula | C15H26N4O8 |
|---|---|
| Molecular weight | 390.39 g/mol |
| IUPAC name | 2-amino-6-[[(4R)-4-[[(2S)-2-aminopropanoyl]amino]-4-carboxybutanoyl]amino]heptanedioic acid |
| InChIKey | FMNCPUGORYYCEM-AUXWQGHOSA-N |
| SMILES | C[C@@H](C(=O)N[C@H](CCC(=O)NC(CCCC(C(=O)O)N)C(=O)O)C(=O)O)N |
Computed by PubChem (NCBI)