Products 87787-04-0

CAS 87787-04-0 is the registry number for CYclohexanecarboxylic acid, 4-hydroxy-1-methyl-, cis-, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

4-hydroxy-1-methylcyclohexane-1-carboxylic acid (CAS 87787-04-0) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: 4-hydroxy-1-methylcyclohexane-1-carboxylic acid. InChIKey: NRJADRDKYOBCKH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14O3
Molecular weight158.19 g/mol
IUPAC name4-hydroxy-1-methylcyclohexane-1-carboxylic acid
InChIKeyNRJADRDKYOBCKH-UHFFFAOYSA-N
SMILESCC1(CCC(CC1)O)C(=O)O

Computed by PubChem (NCBI)