CAS 877928-42-2 is the registry number for 2-(1,3-Thiazol-4-yl)-1H-1,3-benzodiazole-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(1,3-thiazol-4-yl)-3H-benzimidazole-5-carbonitrile (CAS 877928-42-2) is a chemical compound with the molecular formula C11H6N4S and a molecular weight of 226.26 g/mol. IUPAC name: 2-(1,3-thiazol-4-yl)-3H-benzimidazole-5-carbonitrile. InChIKey: DTQNURVJUCHZDE-UHFFFAOYSA-N.
| Molecular formula | C11H6N4S |
|---|---|
| Molecular weight | 226.26 g/mol |
| IUPAC name | 2-(1,3-thiazol-4-yl)-3H-benzimidazole-5-carbonitrile |
| InChIKey | DTQNURVJUCHZDE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)NC(=N2)C3=CSC=N3 |
Computed by PubChem (NCBI)