CAS 877950-01-1 appears in our catalog under these names: LtaS–IN–1, LtaS-IN-1, LtaS-IN-1, 99.58%, LtaS-IN-1/ 91.75% (existing batch purity). Offered by: GLPBio, Chemat, MedChemExpress, TargetMol. Available pack sizes: 10mg, 100mg, 5mg, 50mg, 25mg, 200mg, 1mg, 50 mg.
[2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] 2-benzo[e][1]benzofuran-1-ylacetate (CAS 877950-01-1) is a chemical compound with the molecular formula C24H17N3O5 and a molecular weight of 427.4 g/mol. IUPAC name: [2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] 2-benzo[e][1]benzofuran-1-ylacetate. InChIKey: KNJXREYSQNBQEX-UHFFFAOYSA-N.
| Molecular formula | C24H17N3O5 |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | [2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] 2-benzo[e][1]benzofuran-1-ylacetate |
| InChIKey | KNJXREYSQNBQEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)NC(=O)COC(=O)CC3=COC4=C3C5=CC=CC=C5C=C4 |
Computed by PubChem (NCBI)