CAS 877964-15-3 appears in our catalog under these names: 2-[[(4-Fluorophenyl)sulfonyl](methyl)amino]ethanesulfonyl fluoride, 95%, 2-(4-Fluoro-N-methylphenylsulfonamido)ethanesulfonyl fluoride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
2-[(4-fluorophenyl)sulfonyl-methylamino]ethanesulfonyl fluoride (CAS 877964-15-3) is a chemical compound with the molecular formula C9H11F2NO4S2 and a molecular weight of 299.3 g/mol. IUPAC name: 2-[(4-fluorophenyl)sulfonyl-methylamino]ethanesulfonyl fluoride. InChIKey: QTAVGCCUOCJQIP-UHFFFAOYSA-N.
| Molecular formula | C9H11F2NO4S2 |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)sulfonyl-methylamino]ethanesulfonyl fluoride |
| InChIKey | QTAVGCCUOCJQIP-UHFFFAOYSA-N |
| SMILES | CN(CCS(=O)(=O)F)S(=O)(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)