CAS 878-17-1 is the registry number for 1-(2-Hydroxyphenyl)ethane-1,2-diol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-dichlorophosphoryloxy-4-methylbenzene (CAS 878-17-1) is a chemical compound with the molecular formula C7H7Cl2O2P and a molecular weight of 225.01 g/mol. IUPAC name: 1-dichlorophosphoryloxy-4-methylbenzene. InChIKey: OSDCKQFKYUESEG-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2O2P |
|---|---|
| Molecular weight | 225.01 g/mol |
| IUPAC name | 1-dichlorophosphoryloxy-4-methylbenzene |
| InChIKey | OSDCKQFKYUESEG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OP(=O)(Cl)Cl |
Computed by PubChem (NCBI)