CAS 878047-39-3 is the registry number for rel-(1R,4R)-Bicyclo[2.2.1]hept-5-en-2-ylmethanol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methanol (CAS 878047-39-3) is a chemical compound with the molecular formula C8H12O and a molecular weight of 124.18 g/mol. IUPAC name: [(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methanol. InChIKey: LUMNWCHHXDUKFI-KVARREAHSA-N.
| Molecular formula | C8H12O |
|---|---|
| Molecular weight | 124.18 g/mol |
| IUPAC name | [(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| InChIKey | LUMNWCHHXDUKFI-KVARREAHSA-N |
| SMILES | C1[C@@H]2CC([C@H]1C=C2)CO |
Computed by PubChem (NCBI)