Products 878080-31-0
CAS 878080-31-0 is the registry number for 2-(2-(Dimethylamino)-4-phenylthiazol-5-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(dimethylamino)-4-phenyl-1,3-thiazol-5-yl]acetic acid (CAS 878080-31-0) is a chemical compound with the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. IUPAC name: 2-[2-(dimethylamino)-4-phenyl-1,3-thiazol-5-yl]acetic acid. InChIKey: RKPUITFATWOKIT-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | 2-[2-(dimethylamino)-4-phenyl-1,3-thiazol-5-yl]acetic acid |
| InChIKey | RKPUITFATWOKIT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=C(S1)CC(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)