Products 878204-82-1

CAS 878204-82-1 appears in our catalog under these names: 2,6-Difluorobenzyl mercaptan, 95%, (2,6-Difluorophenyl)methanethiol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.

Structural formula: {0} (CAS {1})

(2,6-difluorophenyl)methanethiol (CAS 878204-82-1) is a chemical compound with the molecular formula C7H6F2S and a molecular weight of 160.19 g/mol. IUPAC name: (2,6-difluorophenyl)methanethiol. InChIKey: WPLAKERHHWPZCA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6F2S
Molecular weight160.19 g/mol
IUPAC name(2,6-difluorophenyl)methanethiol
InChIKeyWPLAKERHHWPZCA-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)F)CS)F

Computed by PubChem (NCBI)