Products 878205-29-9
CAS 878205-29-9 appears in our catalog under these names: Butanedioic-13C4 Acid 1-Methyl Ester, 4-Methoxy-4-oxobutanoic acid-13C4. Offered by: TRC, MedChemExpress. Available pack sizes: 1mg, 1 mg.
4-methoxy-4-oxo(1,2,3,4-13C4)butanoic acid (CAS 878205-29-9) is a chemical compound with the molecular formula C5H8O4 and a molecular weight of 136.09 g/mol. IUPAC name: 4-methoxy-4-oxo(1,2,3,4-13C4)butanoic acid. InChIKey: JDRMYOQETPMYQX-LBHFFFFPSA-N.
| Molecular formula | C5H8O4 |
|---|---|
| Molecular weight | 136.09 g/mol |
| IUPAC name | 4-methoxy-4-oxo(1,2,3,4-13C4)butanoic acid |
| InChIKey | JDRMYOQETPMYQX-LBHFFFFPSA-N |
| SMILES | CO[13C](=O)[13CH2][13CH2][13C](=O)O |
Computed by PubChem (NCBI)