CAS 87826-26-4 appears in our catalog under these names: Diisodecyl 4–Cyclohexene–1,2–dicarboxylate, Diisodecyl 4-Cyclohexene-1,2-dicarboxylate, >97.0%(T), 1,2,3,6-Tetrahydrophthalic acid diisodecyl ester, 97%, Bis(8-methylnonyl) Cyclohex-4-ene-1,2-dicarboxylate, >95% (HPLC), Bis(8-methylnonyl) cyclohex-4-ene-1,2-dicarboxylate 97%. Offered by: GLPBio, TCI, Combi-blocks, TRC, Ambeed. Available pack sizes: 100ml, 25ml, 500ml, 25g, 5g, 100g, 1g, 2,5g.
Bis(8-methylnonyl) cyclohex-4-ene-1,2-dicarboxylate (CAS 87826-26-4) is a chemical compound with the molecular formula C28H50O4 and a molecular weight of 450.7 g/mol. IUPAC name: bis(8-methylnonyl) cyclohex-4-ene-1,2-dicarboxylate. InChIKey: XRFYGUOAWVKOCQ-UHFFFAOYSA-N.
| Molecular formula | C28H50O4 |
|---|---|
| Molecular weight | 450.7 g/mol |
| IUPAC name | bis(8-methylnonyl) cyclohex-4-ene-1,2-dicarboxylate |
| InChIKey | XRFYGUOAWVKOCQ-UHFFFAOYSA-N |
| SMILES | CC(C)CCCCCCCOC(=O)C1CC=CCC1C(=O)OCCCCCCCC(C)C |
Computed by PubChem (NCBI)