CAS 878395-93-8 is the registry number for (S)-2-Methyl-n-(thiophen-2-ylmethylene)propane-2-sulfinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
(S)-2-methyl-N-(thiophen-2-ylmethylidene)propane-2-sulfinamide (CAS 878395-93-8) is a chemical compound with the molecular formula C9H13NOS2 and a molecular weight of 215.3 g/mol. IUPAC name: (S)-2-methyl-N-(thiophen-2-ylmethylidene)propane-2-sulfinamide. InChIKey: YYSVBNDDIUTFLR-ZDUSSCGKSA-N.
| Molecular formula | C9H13NOS2 |
|---|---|
| Molecular weight | 215.3 g/mol |
| IUPAC name | (S)-2-methyl-N-(thiophen-2-ylmethylidene)propane-2-sulfinamide |
| InChIKey | YYSVBNDDIUTFLR-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)[S@](=O)N=CC1=CC=CS1 |
Computed by PubChem (NCBI)