Products 878416-74-1
CAS 878416-74-1 is the registry number for EGFR-IN-172. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(3-fluorophenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol (CAS 878416-74-1) is a chemical compound with the molecular formula C22H18FN3O and a molecular weight of 359.4 g/mol. IUPAC name: 7-[(3-fluorophenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol. InChIKey: OTFQEKBHSZDRLM-UHFFFAOYSA-N.
| Molecular formula | C22H18FN3O |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 7-[(3-fluorophenyl)-[(4-methyl-2-pyridinyl)amino]methyl]quinolin-8-ol |
| InChIKey | OTFQEKBHSZDRLM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)NC(C2=CC(=CC=C2)F)C3=C(C4=C(C=CC=N4)C=C3)O |
Computed by PubChem (NCBI)