CAS 878436-01-2 is the registry number for 2-Amino-5-(2-fluorophenyl)-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(1H,6H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-5-(2-fluorophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (CAS 878436-01-2) is a chemical compound with the molecular formula C13H11FN4O2 and a molecular weight of 274.25 g/mol. IUPAC name: 2-amino-5-(2-fluorophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione. InChIKey: QAMXVEWKCSAABG-UHFFFAOYSA-N.
| Molecular formula | C13H11FN4O2 |
|---|---|
| Molecular weight | 274.25 g/mol |
| IUPAC name | 2-amino-5-(2-fluorophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| InChIKey | QAMXVEWKCSAABG-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(NC1=O)N=C(NC2=O)N)C3=CC=CC=C3F |
Computed by PubChem (NCBI)