CAS 878572-17-9 appears in our catalog under these names: 4-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acid, 95%, 4-Fluoro-3-nitro-5-(trifluoromethyl)benzoic Acid, >95% (HPLC), 4-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acid, 97% , 4-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acid, 97%, 97%, 4-Fluoro-3-nitro-5-(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg, 50mg.
4-fluoro-3-nitro-5-(trifluoromethyl)benzoic acid (CAS 878572-17-9) is a chemical compound with the molecular formula C8H3F4NO4 and a molecular weight of 253.11 g/mol. IUPAC name: 4-fluoro-3-nitro-5-(trifluoromethyl)benzoic acid. InChIKey: XCZRYPKVIJEHSU-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NO4 |
|---|---|
| Molecular weight | 253.11 g/mol |
| IUPAC name | 4-fluoro-3-nitro-5-(trifluoromethyl)benzoic acid |
| InChIKey | XCZRYPKVIJEHSU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)