CAS 878663-12-8 is the registry number for (R)-Norfluoxetine Phthalimide. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg.
2-[(3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]isoindole-1,3-dione (CAS 878663-12-8) is a chemical compound with the molecular formula C24H18F3NO3 and a molecular weight of 425.4 g/mol. IUPAC name: 2-[(3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]isoindole-1,3-dione. InChIKey: HBVJWKXCFVAHNT-OAQYLSRUSA-N.
| Molecular formula | C24H18F3NO3 |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | 2-[(3R)-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]isoindole-1,3-dione |
| InChIKey | HBVJWKXCFVAHNT-OAQYLSRUSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CCN2C(=O)C3=CC=CC=C3C2=O)OC4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)