CAS 878745-43-8 appears in our catalog under these names: 4-(Aminomethyl)-N,N-diethylbenzene-1-sulfonamide hydrochloride, 95%, 4-(Aminomethyl)-N,N-diethylbenzene-1-sulfonamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(aminomethyl)-N,N-diethylbenzenesulfonamide;hydrochloride (CAS 878745-43-8) is a chemical compound with the molecular formula C11H19ClN2O2S and a molecular weight of 278.80 g/mol. IUPAC name: 4-(aminomethyl)-N,N-diethylbenzenesulfonamide;hydrochloride. InChIKey: JKAGQLVSIQOEBH-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2O2S |
|---|---|
| Molecular weight | 278.80 g/mol |
| IUPAC name | 4-(aminomethyl)-N,N-diethylbenzenesulfonamide;hydrochloride |
| InChIKey | JKAGQLVSIQOEBH-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)