Products 878771-07-4

CAS 878771-07-4 appears in our catalog under these names: 4–Methyl–1–piperazinecarboxylic acid hydrochloride, 4-Methylpiperazine-1-carboxylic acid hydrochloride, 95%, 4-Methylpiperazine-1-carboxylic acid hydrochloride, 97%, 4-Methyl-1-piperazinecarboxylic acid hydrochloride, 95%, 95%. Offered by: GLPBio, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 50mg, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

4-methylpiperazine-1-carboxylic acid;hydrochloride (CAS 878771-07-4) is a chemical compound with the molecular formula C6H13ClN2O2 and a molecular weight of 180.63 g/mol. IUPAC name: 4-methylpiperazine-1-carboxylic acid;hydrochloride. InChIKey: WHRPRRMXVSJTGW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13ClN2O2
Molecular weight180.63 g/mol
IUPAC name4-methylpiperazine-1-carboxylic acid;hydrochloride
InChIKeyWHRPRRMXVSJTGW-UHFFFAOYSA-N
SMILESCN1CCN(CC1)C(=O)O.Cl

Computed by PubChem (NCBI)