CAS 878905-16-9 appears in our catalog under these names: Fmoc-5,5-difluoro-L-norleucine, Fmoc-5,5-DiF-Nle-OH 95%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5,5-difluorohexanoic acid, ≥95%(210nm), ≥95%(210nm). Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g, 100mg, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5-difluorohexanoic acid (CAS 878905-16-9) is a chemical compound with the molecular formula C21H21F2NO4 and a molecular weight of 389.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5-difluorohexanoic acid. InChIKey: DLKLKUHHYAZSFD-SFHVURJKSA-N.
| Molecular formula | C21H21F2NO4 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5-difluorohexanoic acid |
| InChIKey | DLKLKUHHYAZSFD-SFHVURJKSA-N |
| SMILES | CC(CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)(F)F |
Computed by PubChem (NCBI)