Products 878905-19-2
CAS 878905-19-2 is the registry number for (S)-2-Amino-5,5-difluorohexanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-5,5-difluorohexanoic acid;hydrochloride (CAS 878905-19-2) is a chemical compound with the molecular formula C6H12ClF2NO2 and a molecular weight of 203.61 g/mol. IUPAC name: (2S)-2-amino-5,5-difluorohexanoic acid;hydrochloride. InChIKey: LQMMUWJUKCIAMM-WCCKRBBISA-N.
| Molecular formula | C6H12ClF2NO2 |
|---|---|
| Molecular weight | 203.61 g/mol |
| IUPAC name | (2S)-2-amino-5,5-difluorohexanoic acid;hydrochloride |
| InChIKey | LQMMUWJUKCIAMM-WCCKRBBISA-N |
| SMILES | CC(CC[C@@H](C(=O)O)N)(F)F.Cl |
Computed by PubChem (NCBI)