CAS 878925-51-0 is the registry number for 2-{(5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl)sulfanyl}propanamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide (CAS 878925-51-0) is a chemical compound with the molecular formula C15H19N3O2S and a molecular weight of 305.4 g/mol. IUPAC name: 2-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide. InChIKey: YUJZUFKJISFNHN-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O2S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 2-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide |
| InChIKey | YUJZUFKJISFNHN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N)SC1=NN=C(O1)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)