CAS 878940-45-5 is the registry number for 5-(((5-(Furan-2-yl)isoxazol-3-yl)methyl)thio)-1,3,4-thiadiazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]-1,3,4-thiadiazol-2-amine (CAS 878940-45-5) is a chemical compound with the molecular formula C10H8N4O2S2 and a molecular weight of 280.3 g/mol. IUPAC name: 5-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]-1,3,4-thiadiazol-2-amine. InChIKey: VBBVTDGJYQKWTA-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O2S2 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | 5-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | VBBVTDGJYQKWTA-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC(=NO2)CSC3=NN=C(S3)N |
Computed by PubChem (NCBI)