CAS 879-05-0 appears in our catalog under these names: Pentafluorophenylmagnesium bromide, 0.5M solution in diethyl ether, AcroSeal®, PENTAFLUOROPHENYLMAGNESIUM BROMIDE, &. Offered by: Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100ML.
Magnesium;1,2,3,4,5-pentafluorobenzene-6-ide;bromide (CAS 879-05-0) is a chemical compound with the molecular formula C6BrF5Mg and a molecular weight of 271.27 g/mol. IUPAC name: magnesium;1,2,3,4,5-pentafluorobenzene-6-ide;bromide. InChIKey: AMQDBUIQKQUCKY-UHFFFAOYSA-M.
| Molecular formula | C6BrF5Mg |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | magnesium;1,2,3,4,5-pentafluorobenzene-6-ide;bromide |
| InChIKey | AMQDBUIQKQUCKY-UHFFFAOYSA-M |
| SMILES | [C-]1=C(C(=C(C(=C1F)F)F)F)F.[Mg+2].[Br-] |
Computed by PubChem (NCBI)