CAS 879-67-4 is the registry number for 2-methoxy-4-methylphenyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2-methoxy-4-methylphenyl) acetate (CAS 879-67-4) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: (2-methoxy-4-methylphenyl) acetate. InChIKey: OMYVQMNBUXUYLM-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (2-methoxy-4-methylphenyl) acetate |
| InChIKey | OMYVQMNBUXUYLM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC(=O)C)OC |
Computed by PubChem (NCBI)