CAS 879020-35-6 is the registry number for [3-Chloro-4-(4-cinnamoylpiperazin-1-yl)phenyl]amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-1-[4-(4-amino-2-chlorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one (CAS 879020-35-6) is a chemical compound with the molecular formula C19H20ClN3O and a molecular weight of 341.8 g/mol. IUPAC name: (E)-1-[4-(4-amino-2-chlorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one. InChIKey: MSMFNYNBUOKSDJ-RMKNXTFCSA-N.
| Molecular formula | C19H20ClN3O |
|---|---|
| Molecular weight | 341.8 g/mol |
| IUPAC name | (E)-1-[4-(4-amino-2-chlorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one |
| InChIKey | MSMFNYNBUOKSDJ-RMKNXTFCSA-N |
| SMILES | C1CN(CCN1C2=C(C=C(C=C2)N)Cl)C(=O)/C=C/C3=CC=CC=C3 |
Computed by PubChem (NCBI)