CAS 879153-35-2 is the registry number for N-(2-(2-Fluorophenyl)ethyl)-8-quinolinecarboxamide. Offered by: TRC. Available pack sizes: 100mg.
N-[2-(2-fluorophenyl)ethyl]quinoline-8-carboxamide (CAS 879153-35-2) is a chemical compound with the molecular formula C18H15FN2O and a molecular weight of 294.3 g/mol. IUPAC name: N-[2-(2-fluorophenyl)ethyl]quinoline-8-carboxamide. InChIKey: GVUUQUYUDXJVQD-UHFFFAOYSA-N.
| Molecular formula | C18H15FN2O |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | N-[2-(2-fluorophenyl)ethyl]quinoline-8-carboxamide |
| InChIKey | GVUUQUYUDXJVQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCNC(=O)C2=CC=CC3=C2N=CC=C3)F |
Computed by PubChem (NCBI)