CAS 87921-48-0 appears in our catalog under these names: 2-(Dibromomethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95.0%, 2-(Dibromomethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
2-(dibromomethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 87921-48-0) is a chemical compound with the molecular formula C7H13BBr2O2 and a molecular weight of 299.80 g/mol. IUPAC name: 2-(dibromomethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LFJFHEZDHXPBCP-UHFFFAOYSA-N.
| Molecular formula | C7H13BBr2O2 |
|---|---|
| Molecular weight | 299.80 g/mol |
| IUPAC name | 2-(dibromomethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LFJFHEZDHXPBCP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(Br)Br |
Computed by PubChem (NCBI)