CAS 879288-18-3 appears in our catalog under these names: Methyl 4-(2,7-difluoro-6-hydroxy-3-oxo-3H-xanthen-9-yl)-3-methylbenzoate, 95+%, 4-Carboxy-pennsylvania green methyl ester, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Methyl 4-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-3-methylbenzoate (CAS 879288-18-3) is a chemical compound with the molecular formula C22H14F2O5 and a molecular weight of 396.3 g/mol. IUPAC name: methyl 4-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-3-methylbenzoate. InChIKey: DPZLMQCYZDHMGJ-UHFFFAOYSA-N.
| Molecular formula | C22H14F2O5 |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | methyl 4-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)-3-methylbenzoate |
| InChIKey | DPZLMQCYZDHMGJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC)C2=C3C=C(C(=O)C=C3OC4=CC(=C(C=C42)F)O)F |
Computed by PubChem (NCBI)